Urolithin B (1139-83-9) کارخانه تولید کننده

اورولیتین B

نوامبر 9، 2020

Urolithin BSpecifications

نام: اورولیتین B
نام شیمیایی: 3-هیدروکسی-6H-dibenzo [b، d] پیران-6-یک
CAS: 1139-83-9
فرمول شیمیایی: C13H8O3
وزن مولکولی: X
رنگ:  پودر سفید
کلید InChi: WXUQMTRHPNOXBV-UHFFFAOYSA-N
کد SMILES: O=C1C2=CC=CC=C2C3=CC=C(O)C=C3O1
عملکرد: Urolithin B می تواند عملکرد میتوکندری و عضله را بهبود بخشد.

Urolithin B می تواند قدرت و استقامت عضلات را در دوران پیری بهبود بخشد.

کاربرد: Urolithin B یک متابولیت میکروبی روده ای ellagitannis است و بسته به سیستم و شرایط سنجش ، فعالیت های آنتی اکسیدانی و طرفداری از اکسیدان قوی را نشان می دهد. Urolithin B همچنین می تواند فعالیت استروژنی و / یا ضد استروژنی را نشان دهد.
انحلال پذیری: به راحتی در N ، N-dimethylformamide و dimethylmethylene محلول است. سولفون ، کمی در محلول در متانول ، اتانول و اتیل استات
دمای نگهداری: یخچال فریزر، -20 ° C یخچال فریزر، در فضای بی هوازی
شرایط حمل و نقل: به عنوان مواد شیمیایی غیر خطرناک تحت دمای محیط حمل می شود. این محصول به مدت چند هفته در طول حمل و نقل عادی و زمان صرف گمرکی به اندازه کافی پایدار است.